C18H20FN3O3S2 — CID 87618610
(5S)-3-(3-fluoro-4-thiomorpholin-4-ylphenyl)-5-[(furan-2-ylsulfanylamino)methyl]-1,3-oxazolidin-2-one (PubChem CID 87618610) has the molecular formula C18H20FN3O3S2 and a molecular weight of 409.51 g/mol. Its IUPAC name is (5S)-3-(3-fluoro-4-thiomorpholin-4-ylphenyl)-5-[(furan-2-ylsulfanylamino)methyl]-1,3-oxazolidin-2-one.
| Compound Name | (5S)-3-(3-fluoro-4-thiomorpholin-4-ylphenyl)-5-[(furan-2-ylsulfanylamino)methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 87618610 |
| Molecular Formula | C18H20FN3O3S2 |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | (5S)-3-(3-fluoro-4-thiomorpholin-4-ylphenyl)-5-[(furan-2-ylsulfanylamino)methyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1O[C@H](CNSc2ccco2)CN1c1ccc(N2CCSCC2)c(F)c1 |
| InChI | InChI=1S/C18H20FN3O3S2/c19-15-10-13(3-4-16(15)21-5-8-26-9-6-21)22-12-14(25-18(22)23)11-20-27-17-2-1-7-24-17/h1-4,7,10,14,20H,5-6,8-9,11-12H2/t14-/m1/s1 |
| InChIKey | LQRVDWNPEASHLD-CQSZACIVSA-N |
| XLogP | 3.59 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|