C20H21ClFN3O3S2 — CID 142192705
6-chloro-N-[[3-(3-fluoro-4-thiomorpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-4H-thiopyran-2-carboxamide (PubChem CID 142192705) has the molecular formula C20H21ClFN3O3S2 and a molecular weight of 469.99 g/mol. Its IUPAC name is 6-chloro-N-[[3-(3-fluoro-4-thiomorpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-4H-thiopyran-2-carboxamide.
| Compound Name | 6-chloro-N-[[3-(3-fluoro-4-thiomorpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-4H-thiopyran-2-carboxamide |
|---|---|
| PubChem CID | 142192705 |
| Molecular Formula | C20H21ClFN3O3S2 |
| Molecular Weight | 469.99 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | 6-chloro-N-[[3-(3-fluoro-4-thiomorpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-4H-thiopyran-2-carboxamide |
| SMILES | O=C(NCC1CN(c2ccc(N3CCSCC3)c(F)c2)C(=O)O1)C1=CCC=C(Cl)S1 |
| InChI | InChI=1S/C20H21ClFN3O3S2/c21-18-3-1-2-17(30-18)19(26)23-11-14-12-25(20(27)28-14)13-4-5-16(15(22)10-13)24-6-8-29-9-7-24/h2-5,10,14H,1,6-9,11-12H2,(H,23,26) |
| InChIKey | MHONOBRXXJWPOP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.99 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|