C28H26FN3O4S — CID 10459310
(Z)-N-[[(5S)-3-(3-fluoro-4-thiomorpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-4-naphthalen-2-yl-4-oxobut-2-enamide (PubChem CID 10459310) has the molecular formula C28H26FN3O4S and a molecular weight of 519.60 g/mol. Its IUPAC name is (Z)-N-[[(5S)-3-(3-fluoro-4-thiomorpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-4-naphthalen-2-yl-4-oxobut-2-enamide.
| Compound Name | (Z)-N-[[(5S)-3-(3-fluoro-4-thiomorpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-4-naphthalen-2-yl-4-oxobut-2-enamide |
|---|---|
| PubChem CID | 10459310 |
| Molecular Formula | C28H26FN3O4S |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | (Z)-N-[[(5S)-3-(3-fluoro-4-thiomorpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-4-naphthalen-2-yl-4-oxobut-2-enamide |
| SMILES | O=C(/C=C\C(=O)c1ccc2ccccc2c1)NC[C@H]1CN(c2ccc(N3CCSCC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C28H26FN3O4S/c29-24-16-22(7-8-25(24)31-11-13-37-14-12-31)32-18-23(36-28(32)35)17-30-27(34)10-9-26(33)21-6-5-19-3-1-2-4-20(19)15-21/h1-10,15-16,23H,11-14,17-18H2,(H,30,34)/b10-9-/t23-/m0/s1 |
| InChIKey | BMNIUXNMPUWHRY-AXKWSIDASA-N |
| XLogP | 4.41 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|