C27H29FN4O5S — CID 10174919
N-[[(5S)-3-[3-fluoro-4-[4-[(E)-4-(4-methoxyphenyl)-4-oxobut-2-enoyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide (PubChem CID 10174919) has the molecular formula C27H29FN4O5S and a molecular weight of 540.62 g/mol. Its IUPAC name is N-[[(5S)-3-[3-fluoro-4-[4-[(E)-4-(4-methoxyphenyl)-4-oxobut-2-enoyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide.
| Compound Name | N-[[(5S)-3-[3-fluoro-4-[4-[(E)-4-(4-methoxyphenyl)-4-oxobut-2-enoyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
|---|---|
| PubChem CID | 10174919 |
| Molecular Formula | C27H29FN4O5S |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | N-[[(5S)-3-[3-fluoro-4-[4-[(E)-4-(4-methoxyphenyl)-4-oxobut-2-enoyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
| SMILES | COc1ccc(C(=O)/C=C/C(=O)N2CCN(c3ccc(N4C[C@H](CNC(C)=S)OC4=O)cc3F)CC2)cc1 |
| InChI | InChI=1S/C27H29FN4O5S/c1-18(38)29-16-22-17-32(27(35)37-22)20-5-8-24(23(28)15-20)30-11-13-31(14-12-30)26(34)10-9-25(33)19-3-6-21(36-2)7-4-19/h3-10,15,22H,11-14,16-17H2,1-2H3,(H,29,38)/b10-9+/t22-/m0/s1 |
| InChIKey | MKLTYFKUKXPJPI-CZQLGGELSA-N |
| XLogP | 3.18 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|