C26H29FN4O7S — CID 10128923
[4-[(E)-3-[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-3-oxoprop-1-enyl]phenyl] methanesulfonate (PubChem CID 10128923) has the molecular formula C26H29FN4O7S and a molecular weight of 560.60 g/mol. Its IUPAC name is [4-[(E)-3-[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-3-oxoprop-1-enyl]phenyl] methanesulfonate.
| Compound Name | [4-[(E)-3-[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-3-oxoprop-1-enyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 10128923 |
| Molecular Formula | C26H29FN4O7S |
| Molecular Weight | 560.60 g/mol |
| Exact Mass | 560.17 |
| IUPAC Name | [4-[(E)-3-[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-3-oxoprop-1-enyl]phenyl] methanesulfonate |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(N3CCN(C(=O)/C=C/c4ccc(OS(C)(=O)=O)cc4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C26H29FN4O7S/c1-18(32)28-16-22-17-31(26(34)37-22)20-6-9-24(23(27)15-20)29-11-13-30(14-12-29)25(33)10-5-19-3-7-21(8-4-19)38-39(2,35)36/h3-10,15,22H,11-14,16-17H2,1-2H3,(H,28,32)/b10-5+/t22-/m0/s1 |
| InChIKey | FBBSSTLKTVXAHJ-FNNZQJQASA-N |
| XLogP | 1.99 |
| TPSA | 125.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.60 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|