C24H26FN5O3S — CID 10195670
N-[[(5S)-3-[3-fluoro-4-[4-[(E)-3-pyridin-3-ylprop-2-enoyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide (PubChem CID 10195670) has the molecular formula C24H26FN5O3S and a molecular weight of 483.57 g/mol. Its IUPAC name is N-[[(5S)-3-[3-fluoro-4-[4-[(E)-3-pyridin-3-ylprop-2-enoyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide.
| Compound Name | N-[[(5S)-3-[3-fluoro-4-[4-[(E)-3-pyridin-3-ylprop-2-enoyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
|---|---|
| PubChem CID | 10195670 |
| Molecular Formula | C24H26FN5O3S |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | N-[[(5S)-3-[3-fluoro-4-[4-[(E)-3-pyridin-3-ylprop-2-enoyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]ethanethioamide |
| SMILES | CC(=S)NC[C@H]1CN(c2ccc(N3CCN(C(=O)/C=C/c4cccnc4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C24H26FN5O3S/c1-17(34)27-15-20-16-30(24(32)33-20)19-5-6-22(21(25)13-19)28-9-11-29(12-10-28)23(31)7-4-18-3-2-8-26-14-18/h2-8,13-14,20H,9-12,15-16H2,1H3,(H,27,34)/b7-4+/t20-/m0/s1 |
| InChIKey | REWNZOYJZWKDEV-PDGUBNMISA-N |
| XLogP | 2.84 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|