C29H31FN4O8 — CID 10289902
[4-[(E)-3-[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-3-oxoprop-1-enyl]-2-acetyloxyphenyl] acetate (PubChem CID 10289902) has the molecular formula C29H31FN4O8 and a molecular weight of 582.59 g/mol. Its IUPAC name is [4-[(E)-3-[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-3-oxoprop-1-enyl]-2-acetyloxyphenyl] acetate.
| Compound Name | [4-[(E)-3-[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-3-oxoprop-1-enyl]-2-acetyloxyphenyl] acetate |
|---|---|
| PubChem CID | 10289902 |
| Molecular Formula | C29H31FN4O8 |
| Molecular Weight | 582.59 g/mol |
| Exact Mass | 582.21 |
| IUPAC Name | [4-[(E)-3-[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-3-oxoprop-1-enyl]-2-acetyloxyphenyl] acetate |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(N3CCN(C(=O)/C=C/c4ccc(OC(C)=O)c(OC(C)=O)c4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C29H31FN4O8/c1-18(35)31-16-23-17-34(29(39)42-23)22-6-7-25(24(30)15-22)32-10-12-33(13-11-32)28(38)9-5-21-4-8-26(40-19(2)36)27(14-21)41-20(3)37/h4-9,14-15,23H,10-13,16-17H2,1-3H3,(H,31,35)/b9-5+/t23-/m0/s1 |
| InChIKey | XKWNPNFUTVNKOX-LKYAVPRHSA-N |
| XLogP | 2.50 |
| TPSA | 134.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.59 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|