C25H26FN3O4 — CID 10366553
(Z)-N-[[(5S)-3-(3-fluoro-4-piperidin-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-4-oxo-4-phenylbut-2-enamide (PubChem CID 10366553) has the molecular formula C25H26FN3O4 and a molecular weight of 451.50 g/mol. Its IUPAC name is (Z)-N-[[(5S)-3-(3-fluoro-4-piperidin-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-4-oxo-4-phenylbut-2-enamide.
| Compound Name | (Z)-N-[[(5S)-3-(3-fluoro-4-piperidin-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-4-oxo-4-phenylbut-2-enamide |
|---|---|
| PubChem CID | 10366553 |
| Molecular Formula | C25H26FN3O4 |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | (Z)-N-[[(5S)-3-(3-fluoro-4-piperidin-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-4-oxo-4-phenylbut-2-enamide |
| SMILES | O=C(/C=C\C(=O)c1ccccc1)NC[C@H]1CN(c2ccc(N3CCCCC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C25H26FN3O4/c26-21-15-19(9-10-22(21)28-13-5-2-6-14-28)29-17-20(33-25(29)32)16-27-24(31)12-11-23(30)18-7-3-1-4-8-18/h1,3-4,7-12,15,20H,2,5-6,13-14,16-17H2,(H,27,31)/b12-11-/t20-/m0/s1 |
| InChIKey | UDWAMYIWGDQFIX-DUQGCJEPSA-N |
| XLogP | 3.70 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|