C26H30FN3O4S — CID 85097039
N-[[3-(3-fluoro-4-piperidin-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-4-oxo-4-[4-(sulfanylmethyl)phenyl]butanamide (PubChem CID 85097039) has the molecular formula C26H30FN3O4S and a molecular weight of 499.61 g/mol. Its IUPAC name is N-[[3-(3-fluoro-4-piperidin-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-4-oxo-4-[4-(sulfanylmethyl)phenyl]butanamide.
| Compound Name | N-[[3-(3-fluoro-4-piperidin-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-4-oxo-4-[4-(sulfanylmethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 85097039 |
| Molecular Formula | C26H30FN3O4S |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | N-[[3-(3-fluoro-4-piperidin-1-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-4-oxo-4-[4-(sulfanylmethyl)phenyl]butanamide |
| SMILES | O=C(CCC(=O)c1ccc(CS)cc1)NCC1CN(c2ccc(N3CCCCC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C26H30FN3O4S/c27-22-14-20(8-9-23(22)29-12-2-1-3-13-29)30-16-21(34-26(30)33)15-28-25(32)11-10-24(31)19-6-4-18(17-35)5-7-19/h4-9,14,21,35H,1-3,10-13,15-17H2,(H,28,32) |
| InChIKey | QHAOMAJREWQFSG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|