C17H23FN4O2S — CID 126496109
5-[[[(Z)-2-aminoethenyl]amino]methyl]-3-[3-fluoro-4-(1,4-thiazepan-4-yl)phenyl]-1,3-oxazolidin-2-one (PubChem CID 126496109) has the molecular formula C17H23FN4O2S and a molecular weight of 366.46 g/mol. Its IUPAC name is 5-[[[(Z)-2-aminoethenyl]amino]methyl]-3-[3-fluoro-4-(1,4-thiazepan-4-yl)phenyl]-1,3-oxazolidin-2-one.
| Compound Name | 5-[[[(Z)-2-aminoethenyl]amino]methyl]-3-[3-fluoro-4-(1,4-thiazepan-4-yl)phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 126496109 |
| Molecular Formula | C17H23FN4O2S |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 5-[[[(Z)-2-aminoethenyl]amino]methyl]-3-[3-fluoro-4-(1,4-thiazepan-4-yl)phenyl]-1,3-oxazolidin-2-one |
| SMILES | N/C=C\NCC1CN(c2ccc(N3CCCSCC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C17H23FN4O2S/c18-15-10-13(2-3-16(15)21-6-1-8-25-9-7-21)22-12-14(24-17(22)23)11-20-5-4-19/h2-5,10,14,20H,1,6-9,11-12,19H2/b5-4- |
| InChIKey | UGCXNQBPGDNHKT-PLNGDYQASA-N |
| XLogP | 2.11 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|