C17H26FN5O2 — CID 143043570
(5S)-5-[2-[[(Z)-2-aminoethenyl]amino]ethyl]-3-(3-fluoro-4-pyrrolidin-1-ylphenyl)-1,3-oxazolidin-2-one;azane (PubChem CID 143043570) has the molecular formula C17H26FN5O2 and a molecular weight of 351.43 g/mol. Its IUPAC name is (5S)-5-[2-[[(Z)-2-aminoethenyl]amino]ethyl]-3-(3-fluoro-4-pyrrolidin-1-ylphenyl)-1,3-oxazolidin-2-one;azane.
| Compound Name | (5S)-5-[2-[[(Z)-2-aminoethenyl]amino]ethyl]-3-(3-fluoro-4-pyrrolidin-1-ylphenyl)-1,3-oxazolidin-2-one;azane |
|---|---|
| PubChem CID | 143043570 |
| Molecular Formula | C17H26FN5O2 |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | (5S)-5-[2-[[(Z)-2-aminoethenyl]amino]ethyl]-3-(3-fluoro-4-pyrrolidin-1-ylphenyl)-1,3-oxazolidin-2-one;azane |
| SMILES | N.N/C=C\NCC[C@H]1CN(c2ccc(N3CCCC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C17H23FN4O2.H3N/c18-15-11-13(3-4-16(15)21-9-1-2-10-21)22-12-14(24-17(22)23)5-7-20-8-6-19;/h3-4,6,8,11,14,20H,1-2,5,7,9-10,12,19H2;1H3/b8-6-;/t14-;/m0./s1 |
| InChIKey | NPPZJVHOMDAYJY-JPBYVTLPSA-N |
| XLogP | 2.32 |
| TPSA | 105.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|