C14H19FN6O2 — CID 143043556
(5R)-5-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-3-[4-[[(Z)-2-aminoethenyl]amino]-3-fluorophenyl]-1,3-oxazolidin-2-one (PubChem CID 143043556) has the molecular formula C14H19FN6O2 and a molecular weight of 322.34 g/mol. Its IUPAC name is (5R)-5-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-3-[4-[[(Z)-2-aminoethenyl]amino]-3-fluorophenyl]-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-3-[4-[[(Z)-2-aminoethenyl]amino]-3-fluorophenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 143043556 |
| Molecular Formula | C14H19FN6O2 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | (5R)-5-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-3-[4-[[(Z)-2-aminoethenyl]amino]-3-fluorophenyl]-1,3-oxazolidin-2-one |
| SMILES | N/C=C\Nc1ccc(N2C[C@H](CN(N)/C=C\N)OC2=O)cc1F |
| InChI | InChI=1S/C14H19FN6O2/c15-12-7-10(1-2-13(12)19-5-3-16)21-9-11(23-14(21)22)8-20(18)6-4-17/h1-7,11,19H,8-9,16-18H2/b5-3-,6-4-/t11-/m0/s1 |
| InChIKey | SCJQGSRQIZEVGJ-NKXCFSKISA-N |
| XLogP | 0.60 |
| TPSA | 122.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|