C22H36FN7O4 — CID 142093051
4-[4-[5-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazine-1-carbaldehyde;2-[ethyl(methyl)amino]ethanol (PubChem CID 142093051) has the molecular formula C22H36FN7O4 and a molecular weight of 481.57 g/mol. Its IUPAC name is 4-[4-[5-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazine-1-carbaldehyde;2-[ethyl(methyl)amino]ethanol.
| Compound Name | 4-[4-[5-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazine-1-carbaldehyde;2-[ethyl(methyl)amino]ethanol |
|---|---|
| PubChem CID | 142093051 |
| Molecular Formula | C22H36FN7O4 |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.28 |
| IUPAC Name | 4-[4-[5-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazine-1-carbaldehyde;2-[ethyl(methyl)amino]ethanol |
| SMILES | CCN(C)CCO.N/C=C\N(N)CC1CN(c2ccc(N3CCN(C=O)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C17H23FN6O3.C5H13NO/c18-15-9-13(1-2-16(15)22-7-5-21(12-25)6-8-22)24-11-14(27-17(24)26)10-23(20)4-3-19;1-3-6(2)4-5-7/h1-4,9,12,14H,5-8,10-11,19-20H2;7H,3-5H2,1-2H3/b4-3-; |
| InChIKey | DFTWXYURWWDTLX-LNKPDPKZSA-N |
| XLogP | -0.03 |
| TPSA | 131.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|