C14H20F2N4O3 — CID 142997061
5-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-3-(3,5-difluoro-4-hydroxyphenyl)-1,3-oxazolidin-2-one;ethane (PubChem CID 142997061) has the molecular formula C14H20F2N4O3 and a molecular weight of 330.34 g/mol. Its IUPAC name is 5-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-3-(3,5-difluoro-4-hydroxyphenyl)-1,3-oxazolidin-2-one;ethane.
| Compound Name | 5-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-3-(3,5-difluoro-4-hydroxyphenyl)-1,3-oxazolidin-2-one;ethane |
|---|---|
| PubChem CID | 142997061 |
| Molecular Formula | C14H20F2N4O3 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 5-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-3-(3,5-difluoro-4-hydroxyphenyl)-1,3-oxazolidin-2-one;ethane |
| SMILES | CC.N/C=C\N(N)CC1CN(c2cc(F)c(O)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C12H14F2N4O3.C2H6/c13-9-3-7(4-10(14)11(9)19)18-6-8(21-12(18)20)5-17(16)2-1-15;1-2/h1-4,8,19H,5-6,15-16H2;1-2H3/b2-1-; |
| InChIKey | XVPWGCDODILTAO-ODZAUARKSA-N |
| XLogP | 1.63 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|