C18H25F2N4O3S+ — CID 142276562
3-[3,5-difluoro-4-(1-hydroxythian-1-ium-4-yl)phenyl]-5-[[(ethyldiazenyl)-methylamino]methyl]-1,3-oxazolidin-2-one (PubChem CID 142276562) has the molecular formula C18H25F2N4O3S+ and a molecular weight of 415.49 g/mol. Its IUPAC name is 3-[3,5-difluoro-4-(1-hydroxythian-1-ium-4-yl)phenyl]-5-[[(ethyldiazenyl)-methylamino]methyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[3,5-difluoro-4-(1-hydroxythian-1-ium-4-yl)phenyl]-5-[[(ethyldiazenyl)-methylamino]methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 142276562 |
| Molecular Formula | C18H25F2N4O3S+ |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 3-[3,5-difluoro-4-(1-hydroxythian-1-ium-4-yl)phenyl]-5-[[(ethyldiazenyl)-methylamino]methyl]-1,3-oxazolidin-2-one |
| SMILES | CC/N=N/N(C)CC1CN(c2cc(F)c(C3CC[S+](O)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C18H25F2N4O3S/c1-3-21-22-23(2)10-14-11-24(18(25)27-14)13-8-15(19)17(16(20)9-13)12-4-6-28(26)7-5-12/h8-9,12,14,26H,3-7,10-11H2,1-2H3/q+1/b22-21+ |
| InChIKey | ACBCKWNQDIIVBQ-QURGRASLSA-N |
| XLogP | 3.58 |
| TPSA | 77.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|