C17H21FN6O2 — CID 142276569
5-[[ethyl-(ethyldiazenyl)amino]methyl]-3-(3-fluoro-4-imidazol-1-ylphenyl)-1,3-oxazolidin-2-one (PubChem CID 142276569) has the molecular formula C17H21FN6O2 and a molecular weight of 360.39 g/mol. Its IUPAC name is 5-[[ethyl-(ethyldiazenyl)amino]methyl]-3-(3-fluoro-4-imidazol-1-ylphenyl)-1,3-oxazolidin-2-one.
| Compound Name | 5-[[ethyl-(ethyldiazenyl)amino]methyl]-3-(3-fluoro-4-imidazol-1-ylphenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 142276569 |
| Molecular Formula | C17H21FN6O2 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 5-[[ethyl-(ethyldiazenyl)amino]methyl]-3-(3-fluoro-4-imidazol-1-ylphenyl)-1,3-oxazolidin-2-one |
| SMILES | CC/N=N/N(CC)CC1CN(c2ccc(-n3ccnc3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C17H21FN6O2/c1-3-20-21-23(4-2)10-14-11-24(17(25)26-14)13-5-6-16(15(18)9-13)22-8-7-19-12-22/h5-9,12,14H,3-4,10-11H2,1-2H3/b21-20+ |
| InChIKey | ORPYFPAJDKJIAJ-QZQOTICOSA-N |
| XLogP | 3.05 |
| TPSA | 75.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|