C17H15FN8O2 — CID 86648044
5-(azidomethyl)-3-[3-fluoro-4-[4-(imidazol-1-ylmethyl)imidazol-1-yl]phenyl]-1,3-oxazolidin-2-one (PubChem CID 86648044) has the molecular formula C17H15FN8O2 and a molecular weight of 382.36 g/mol. Its IUPAC name is 5-(azidomethyl)-3-[3-fluoro-4-[4-(imidazol-1-ylmethyl)imidazol-1-yl]phenyl]-1,3-oxazolidin-2-one.
| Compound Name | 5-(azidomethyl)-3-[3-fluoro-4-[4-(imidazol-1-ylmethyl)imidazol-1-yl]phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 86648044 |
| Molecular Formula | C17H15FN8O2 |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 5-(azidomethyl)-3-[3-fluoro-4-[4-(imidazol-1-ylmethyl)imidazol-1-yl]phenyl]-1,3-oxazolidin-2-one |
| SMILES | [N-]=[N+]=NCC1CN(c2ccc(-n3cnc(Cn4ccnc4)c3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C17H15FN8O2/c18-15-5-13(26-9-14(6-22-23-19)28-17(26)27)1-2-16(15)25-8-12(21-11-25)7-24-4-3-20-10-24/h1-5,8,10-11,14H,6-7,9H2 |
| InChIKey | ROLPULYXFDDUSL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 113.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|