C14H13FN7O3+ — CID 142276605
[(5R)-3-[3-fluoro-4-[4-[(E)-hydroxyiminomethyl]imidazol-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylimino-iminoazanium (PubChem CID 142276605) has the molecular formula C14H13FN7O3+ and a molecular weight of 346.30 g/mol. Its IUPAC name is [(5R)-3-[3-fluoro-4-[4-[(E)-hydroxyiminomethyl]imidazol-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylimino-iminoazanium.
| Compound Name | [(5R)-3-[3-fluoro-4-[4-[(E)-hydroxyiminomethyl]imidazol-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylimino-iminoazanium |
|---|---|
| PubChem CID | 142276605 |
| Molecular Formula | C14H13FN7O3+ |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | [(5R)-3-[3-fluoro-4-[4-[(E)-hydroxyiminomethyl]imidazol-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylimino-iminoazanium |
| SMILES | N=[N+]=NC[C@H]1CN(c2ccc(-n3cnc(/C=N/O)c3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C14H12FN7O3/c15-12-3-10(22-7-11(5-18-20-16)25-14(22)23)1-2-13(12)21-6-9(4-19-24)17-8-21/h1-4,6,8,11,16H,5,7H2/p+1/b19-4+/t11-/m0/s1 |
| InChIKey | WJFMBSGNGIPUGF-CNGVDHBKSA-O |
| XLogP | 1.70 |
| TPSA | 130.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|