C20H27FN6O3Si — CID 18378824
5-(azidomethyl)-3-[4-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]imidazol-1-yl]-3-fluorophenyl]-1,3-oxazolidin-2-one (PubChem CID 18378824) has the molecular formula C20H27FN6O3Si and a molecular weight of 446.56 g/mol. Its IUPAC name is 5-(azidomethyl)-3-[4-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]imidazol-1-yl]-3-fluorophenyl]-1,3-oxazolidin-2-one.
| Compound Name | 5-(azidomethyl)-3-[4-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]imidazol-1-yl]-3-fluorophenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 18378824 |
| Molecular Formula | C20H27FN6O3Si |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 5-(azidomethyl)-3-[4-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]imidazol-1-yl]-3-fluorophenyl]-1,3-oxazolidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cn(-c2ccc(N3CC(CN=[N+]=[N-])OC3=O)cc2F)cn1 |
| InChI | InChI=1S/C20H27FN6O3Si/c1-20(2,3)31(4,5)29-12-14-10-26(13-23-14)18-7-6-15(8-17(18)21)27-11-16(9-24-25-22)30-19(27)28/h6-8,10,13,16H,9,11-12H2,1-5H3 |
| InChIKey | CTYSOJMJMQQIHZ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 105.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|