C16H14FN9O2 — CID 25121946
(5R)-5-(azidomethyl)-3-[3-fluoro-4-[4-(1,2,4-triazol-1-ylmethyl)imidazol-1-yl]phenyl]-1,3-oxazolidin-2-one (PubChem CID 25121946) has the molecular formula C16H14FN9O2 and a molecular weight of 383.35 g/mol. Its IUPAC name is (5R)-5-(azidomethyl)-3-[3-fluoro-4-[4-(1,2,4-triazol-1-ylmethyl)imidazol-1-yl]phenyl]-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-(azidomethyl)-3-[3-fluoro-4-[4-(1,2,4-triazol-1-ylmethyl)imidazol-1-yl]phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 25121946 |
| Molecular Formula | C16H14FN9O2 |
| Molecular Weight | 383.35 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | (5R)-5-(azidomethyl)-3-[3-fluoro-4-[4-(1,2,4-triazol-1-ylmethyl)imidazol-1-yl]phenyl]-1,3-oxazolidin-2-one |
| SMILES | [N-]=[N+]=NC[C@H]1CN(c2ccc(-n3cnc(Cn4cncn4)c3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C16H14FN9O2/c17-14-3-12(26-7-13(4-21-23-18)28-16(26)27)1-2-15(14)24-5-11(20-10-24)6-25-9-19-8-22-25/h1-3,5,8-10,13H,4,6-7H2/t13-/m0/s1 |
| InChIKey | GPSFMYKDWUBLBT-ZDUSSCGKSA-N |
| XLogP | 2.29 |
| TPSA | 126.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|