C16H13FN8O3 — CID 90854865
5-(azidomethyl)-3-[3-fluoro-4-[4-(1,2,4-triazol-1-ylmethyl)-1,3-oxazol-2-yl]phenyl]-1,3-oxazolidin-2-one (PubChem CID 90854865) has the molecular formula C16H13FN8O3 and a molecular weight of 384.33 g/mol. Its IUPAC name is 5-(azidomethyl)-3-[3-fluoro-4-[4-(1,2,4-triazol-1-ylmethyl)-1,3-oxazol-2-yl]phenyl]-1,3-oxazolidin-2-one.
| Compound Name | 5-(azidomethyl)-3-[3-fluoro-4-[4-(1,2,4-triazol-1-ylmethyl)-1,3-oxazol-2-yl]phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 90854865 |
| Molecular Formula | C16H13FN8O3 |
| Molecular Weight | 384.33 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 5-(azidomethyl)-3-[3-fluoro-4-[4-(1,2,4-triazol-1-ylmethyl)-1,3-oxazol-2-yl]phenyl]-1,3-oxazolidin-2-one |
| SMILES | [N-]=[N+]=NCC1CN(c2ccc(-c3nc(Cn4cncn4)co3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C16H13FN8O3/c17-14-3-11(25-6-12(4-20-23-18)28-16(25)26)1-2-13(14)15-22-10(7-27-15)5-24-9-19-8-21-24/h1-3,7-9,12H,4-6H2 |
| InChIKey | QHQADLINMFGKPV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 135.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|