C14H11ClFN5O3 — CID 59591361
(5R)-5-(azidomethyl)-3-[4-[4-(chloromethyl)-1,3-oxazol-2-yl]-3-fluorophenyl]-1,3-oxazolidin-2-one (PubChem CID 59591361) has the molecular formula C14H11ClFN5O3 and a molecular weight of 351.73 g/mol. Its IUPAC name is (5R)-5-(azidomethyl)-3-[4-[4-(chloromethyl)-1,3-oxazol-2-yl]-3-fluorophenyl]-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-(azidomethyl)-3-[4-[4-(chloromethyl)-1,3-oxazol-2-yl]-3-fluorophenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 59591361 |
| Molecular Formula | C14H11ClFN5O3 |
| Molecular Weight | 351.73 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | (5R)-5-(azidomethyl)-3-[4-[4-(chloromethyl)-1,3-oxazol-2-yl]-3-fluorophenyl]-1,3-oxazolidin-2-one |
| SMILES | [N-]=[N+]=NC[C@H]1CN(c2ccc(-c3nc(CCl)co3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C14H11ClFN5O3/c15-4-8-7-23-13(19-8)11-2-1-9(3-12(11)16)21-6-10(5-18-20-17)24-14(21)22/h1-3,7,10H,4-6H2/t10-/m0/s1 |
| InChIKey | ASILLEZHUSYCQC-JTQLQIEISA-N |
| XLogP | 3.86 |
| TPSA | 104.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.73 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|