C17H8F6N4O4 — CID 22966216
(2,3,4,5,6-pentafluorophenyl) 4-[(5S)-5-(azidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorobenzoate (PubChem CID 22966216) has the molecular formula C17H8F6N4O4 and a molecular weight of 446.26 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 4-[(5S)-5-(azidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorobenzoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 4-[(5S)-5-(azidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorobenzoate |
|---|---|
| PubChem CID | 22966216 |
| Molecular Formula | C17H8F6N4O4 |
| Molecular Weight | 446.26 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 4-[(5S)-5-(azidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorobenzoate |
| SMILES | [N-]=[N+]=NC[C@@H]1CN(c2ccc(C(=O)Oc3c(F)c(F)c(F)c(F)c3F)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C17H8F6N4O4/c18-9-3-6(27-5-7(4-25-26-24)30-17(27)29)1-2-8(9)16(28)31-15-13(22)11(20)10(19)12(21)14(15)23/h1-3,7H,4-5H2/t7-/m1/s1 |
| InChIKey | VPRRUVXGLYNNSI-SSDOTTSWSA-N |
| XLogP | 4.38 |
| TPSA | 104.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.26 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|