C12H12FN7O3S — CID 22966220
[[4-[(5S)-5-(azidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorobenzoyl]amino]thiourea (PubChem CID 22966220) has the molecular formula C12H12FN7O3S and a molecular weight of 353.34 g/mol. Its IUPAC name is [[4-[(5S)-5-(azidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorobenzoyl]amino]thiourea.
| Compound Name | [[4-[(5S)-5-(azidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorobenzoyl]amino]thiourea |
|---|---|
| PubChem CID | 22966220 |
| Molecular Formula | C12H12FN7O3S |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | [[4-[(5S)-5-(azidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorobenzoyl]amino]thiourea |
| SMILES | [N-]=[N+]=NC[C@@H]1CN(c2ccc(C(=O)NNC(N)=S)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C12H12FN7O3S/c13-9-3-6(1-2-8(9)10(21)17-18-11(14)24)20-5-7(4-16-19-15)23-12(20)22/h1-3,7H,4-5H2,(H,17,21)(H3,14,18,24)/t7-/m1/s1 |
| InChIKey | QMTGVEJEUQGERL-SSDOTTSWSA-N |
| XLogP | 0.94 |
| TPSA | 145.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|