C16H20FN4O4+ — CID 142236789
[3-[3-fluoro-4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylimino-methyliminoazanium (PubChem CID 142236789) has the molecular formula C16H20FN4O4+ and a molecular weight of 351.36 g/mol. Its IUPAC name is [3-[3-fluoro-4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylimino-methyliminoazanium.
| Compound Name | [3-[3-fluoro-4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylimino-methyliminoazanium |
|---|---|
| PubChem CID | 142236789 |
| Molecular Formula | C16H20FN4O4+ |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | [3-[3-fluoro-4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methylimino-methyliminoazanium |
| SMILES | CN=[N+]=NCC1CN(c2ccc(C(=O)OC(C)(C)C)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C16H20FN4O4/c1-16(2,3)25-14(22)12-6-5-10(7-13(12)17)21-9-11(24-15(21)23)8-19-20-18-4/h5-7,11H,8-9H2,1-4H3/q+1 |
| InChIKey | ZXOLVWWNYVPIDF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 94.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|