C19H28FN7O4 — CID 59531555
tert-butyl N-[2-[N-(2-aminoethyl)-4-[(5R)-5-(azidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluoroanilino]ethyl]carbamate (PubChem CID 59531555) has the molecular formula C19H28FN7O4 and a molecular weight of 437.48 g/mol. Its IUPAC name is tert-butyl N-[2-[N-(2-aminoethyl)-4-[(5R)-5-(azidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluoroanilino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[N-(2-aminoethyl)-4-[(5R)-5-(azidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluoroanilino]ethyl]carbamate |
|---|---|
| PubChem CID | 59531555 |
| Molecular Formula | C19H28FN7O4 |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | tert-butyl N-[2-[N-(2-aminoethyl)-4-[(5R)-5-(azidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluoroanilino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCN(CCN)c1ccc(N2C[C@H](CN=[N+]=[N-])OC2=O)cc1F |
| InChI | InChI=1S/C19H28FN7O4/c1-19(2,3)31-17(28)23-7-9-26(8-6-21)16-5-4-13(10-15(16)20)27-12-14(11-24-25-22)30-18(27)29/h4-5,10,14H,6-9,11-12,21H2,1-3H3,(H,23,28)/t14-/m0/s1 |
| InChIKey | LZGGQGLFDYTXAC-AWEZNQCLSA-N |
| XLogP | 2.75 |
| TPSA | 145.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|