C19H25FN6O4 — CID 139799609
tert-butyl 4-[2-[(5R)-5-(azidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-6-fluorophenyl]piperazine-1-carboxylate (PubChem CID 139799609) has the molecular formula C19H25FN6O4 and a molecular weight of 420.45 g/mol. Its IUPAC name is tert-butyl 4-[2-[(5R)-5-(azidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-6-fluorophenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(5R)-5-(azidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-6-fluorophenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 139799609 |
| Molecular Formula | C19H25FN6O4 |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | tert-butyl 4-[2-[(5R)-5-(azidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-6-fluorophenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2c(F)cccc2N2C[C@H](CN=[N+]=[N-])OC2=O)CC1 |
| InChI | InChI=1S/C19H25FN6O4/c1-19(2,3)30-17(27)25-9-7-24(8-10-25)16-14(20)5-4-6-15(16)26-12-13(11-22-23-21)29-18(26)28/h4-6,13H,7-12H2,1-3H3/t13-/m0/s1 |
| InChIKey | NWGNTEDCASULAZ-ZDUSSCGKSA-N |
| XLogP | 3.52 |
| TPSA | 111.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|