C20H32FN5O4 — CID 70891592
tert-butyl N-[2-[4-[(5S)-5-(aminomethyl)-2-oxo-1,3-oxazolidin-3-yl]-N-ethyl-2-fluoroanilino]ethyl]-N-(methylamino)carbamate (PubChem CID 70891592) has the molecular formula C20H32FN5O4 and a molecular weight of 425.51 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[(5S)-5-(aminomethyl)-2-oxo-1,3-oxazolidin-3-yl]-N-ethyl-2-fluoroanilino]ethyl]-N-(methylamino)carbamate.
| Compound Name | tert-butyl N-[2-[4-[(5S)-5-(aminomethyl)-2-oxo-1,3-oxazolidin-3-yl]-N-ethyl-2-fluoroanilino]ethyl]-N-(methylamino)carbamate |
|---|---|
| PubChem CID | 70891592 |
| Molecular Formula | C20H32FN5O4 |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | tert-butyl N-[2-[4-[(5S)-5-(aminomethyl)-2-oxo-1,3-oxazolidin-3-yl]-N-ethyl-2-fluoroanilino]ethyl]-N-(methylamino)carbamate |
| SMILES | CCN(CCN(NC)C(=O)OC(C)(C)C)c1ccc(N2C[C@H](CN)OC2=O)cc1F |
| InChI | InChI=1S/C20H32FN5O4/c1-6-24(9-10-26(23-5)19(28)30-20(2,3)4)17-8-7-14(11-16(17)21)25-13-15(12-22)29-18(25)27/h7-8,11,15,23H,6,9-10,12-13,22H2,1-5H3/t15-/m0/s1 |
| InChIKey | KOTTXROJAWOQQB-HNNXBMFYSA-N |
| XLogP | 2.31 |
| TPSA | 100.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|