C24H30F3N7O4 — CID 89217889
N-[[(5S)-3-[4-[2-[(4-aminophenyl)carbamoyl-(methylamino)amino]ethyl-ethylamino]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2,2-difluoroacetamide (PubChem CID 89217889) has the molecular formula C24H30F3N7O4 and a molecular weight of 537.54 g/mol. Its IUPAC name is N-[[(5S)-3-[4-[2-[(4-aminophenyl)carbamoyl-(methylamino)amino]ethyl-ethylamino]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2,2-difluoroacetamide.
| Compound Name | N-[[(5S)-3-[4-[2-[(4-aminophenyl)carbamoyl-(methylamino)amino]ethyl-ethylamino]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 89217889 |
| Molecular Formula | C24H30F3N7O4 |
| Molecular Weight | 537.54 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | N-[[(5S)-3-[4-[2-[(4-aminophenyl)carbamoyl-(methylamino)amino]ethyl-ethylamino]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2,2-difluoroacetamide |
| SMILES | CCN(CCN(NC)C(=O)Nc1ccc(N)cc1)c1ccc(N2C[C@H](CNC(=O)C(F)F)OC2=O)cc1F |
| InChI | InChI=1S/C24H30F3N7O4/c1-3-32(10-11-34(29-2)23(36)31-16-6-4-15(28)5-7-16)20-9-8-17(12-19(20)25)33-14-18(38-24(33)37)13-30-22(35)21(26)27/h4-9,12,18,21,29H,3,10-11,13-14,28H2,1-2H3,(H,30,35)(H,31,36)/t18-/m0/s1 |
| InChIKey | MBQVWXZMOJHQSQ-SFHVURJKSA-N |
| XLogP | 2.61 |
| TPSA | 132.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.54 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|