C22H24F4N4O6 — CID 89072884
N-[2-[4-[(5S)-5-[[(2,2-difluoroacetyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-N-ethyl-2,6-difluoroanilino]ethyl]-N-methoxyfuran-2-carboxamide (PubChem CID 89072884) has the molecular formula C22H24F4N4O6 and a molecular weight of 516.45 g/mol. Its IUPAC name is N-[2-[4-[(5S)-5-[[(2,2-difluoroacetyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-N-ethyl-2,6-difluoroanilino]ethyl]-N-methoxyfuran-2-carboxamide.
| Compound Name | N-[2-[4-[(5S)-5-[[(2,2-difluoroacetyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-N-ethyl-2,6-difluoroanilino]ethyl]-N-methoxyfuran-2-carboxamide |
|---|---|
| PubChem CID | 89072884 |
| Molecular Formula | C22H24F4N4O6 |
| Molecular Weight | 516.45 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | N-[2-[4-[(5S)-5-[[(2,2-difluoroacetyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-N-ethyl-2,6-difluoroanilino]ethyl]-N-methoxyfuran-2-carboxamide |
| SMILES | CCN(CCN(OC)C(=O)c1ccco1)c1c(F)cc(N2C[C@H](CNC(=O)C(F)F)OC2=O)cc1F |
| InChI | InChI=1S/C22H24F4N4O6/c1-3-28(6-7-30(34-2)21(32)17-5-4-8-35-17)18-15(23)9-13(10-16(18)24)29-12-14(36-22(29)33)11-27-20(31)19(25)26/h4-5,8-10,14,19H,3,6-7,11-12H2,1-2H3,(H,27,31)/t14-/m0/s1 |
| InChIKey | TXCPHHPGZFQFGZ-AWEZNQCLSA-N |
| XLogP | 2.79 |
| TPSA | 104.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|