C19H27F3N4O6 — CID 89072895
2,2-difluoro-N-[[(5S)-3-[3-fluoro-4-[2-[2-(2-hydroxyethoxy)ethyl-methoxyamino]ethylamino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 89072895) has the molecular formula C19H27F3N4O6 and a molecular weight of 464.44 g/mol. Its IUPAC name is 2,2-difluoro-N-[[(5S)-3-[3-fluoro-4-[2-[2-(2-hydroxyethoxy)ethyl-methoxyamino]ethylamino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | 2,2-difluoro-N-[[(5S)-3-[3-fluoro-4-[2-[2-(2-hydroxyethoxy)ethyl-methoxyamino]ethylamino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 89072895 |
| Molecular Formula | C19H27F3N4O6 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 2,2-difluoro-N-[[(5S)-3-[3-fluoro-4-[2-[2-(2-hydroxyethoxy)ethyl-methoxyamino]ethylamino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CON(CCNc1ccc(N2C[C@H](CNC(=O)C(F)F)OC2=O)cc1F)CCOCCO |
| InChI | InChI=1S/C19H27F3N4O6/c1-30-25(6-8-31-9-7-27)5-4-23-16-3-2-13(10-15(16)20)26-12-14(32-19(26)29)11-24-18(28)17(21)22/h2-3,10,14,17,23,27H,4-9,11-12H2,1H3,(H,24,28)/t14-/m0/s1 |
| InChIKey | WKARCRSTNBMVHU-AWEZNQCLSA-N |
| XLogP | 0.82 |
| TPSA | 112.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|