C20H28ClFN4O4S — CID 143613153
O-butyl N-[2-[4-[(5S)-5-[(2-chloropropanoylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluoroanilino]ethyl]carbamothioate (PubChem CID 143613153) has the molecular formula C20H28ClFN4O4S and a molecular weight of 474.99 g/mol. Its IUPAC name is O-butyl N-[2-[4-[(5S)-5-[(2-chloropropanoylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluoroanilino]ethyl]carbamothioate.
| Compound Name | O-butyl N-[2-[4-[(5S)-5-[(2-chloropropanoylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluoroanilino]ethyl]carbamothioate |
|---|---|
| PubChem CID | 143613153 |
| Molecular Formula | C20H28ClFN4O4S |
| Molecular Weight | 474.99 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | O-butyl N-[2-[4-[(5S)-5-[(2-chloropropanoylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]-2-fluoroanilino]ethyl]carbamothioate |
| SMILES | CCCCOC(=S)NCCNc1ccc(N2C[C@H](CNC(=O)C(C)Cl)OC2=O)cc1F |
| InChI | InChI=1S/C20H28ClFN4O4S/c1-3-4-9-29-19(31)24-8-7-23-17-6-5-14(10-16(17)22)26-12-15(30-20(26)28)11-25-18(27)13(2)21/h5-6,10,13,15,23H,3-4,7-9,11-12H2,1-2H3,(H,24,31)(H,25,27)/t13?,15-/m0/s1 |
| InChIKey | IZRSBEQDWYCWHC-WUJWULDRSA-N |
| XLogP | 3.00 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.99 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|