C20H23FN6O3S — CID 142864449
N-[[(5S)-3-[3-fluoro-4-[2-(pyridin-3-ylcarbamothioylamino)ethylamino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 142864449) has the molecular formula C20H23FN6O3S and a molecular weight of 446.51 g/mol. Its IUPAC name is N-[[(5S)-3-[3-fluoro-4-[2-(pyridin-3-ylcarbamothioylamino)ethylamino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[3-fluoro-4-[2-(pyridin-3-ylcarbamothioylamino)ethylamino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 142864449 |
| Molecular Formula | C20H23FN6O3S |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | N-[[(5S)-3-[3-fluoro-4-[2-(pyridin-3-ylcarbamothioylamino)ethylamino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(NCCNC(=S)Nc3cccnc3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C20H23FN6O3S/c1-13(28)25-11-16-12-27(20(29)30-16)15-4-5-18(17(21)9-15)23-7-8-24-19(31)26-14-3-2-6-22-10-14/h2-6,9-10,16,23H,7-8,11-12H2,1H3,(H,25,28)(H2,24,26,31)/t16-/m0/s1 |
| InChIKey | MZIFAXBKPKUSEW-INIZCTEOSA-N |
| XLogP | 2.08 |
| TPSA | 107.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|