C24H23FN4O5S — CID 88863670
(pyridin-3-ylamino) [4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]phenyl]methanesulfinate (PubChem CID 88863670) has the molecular formula C24H23FN4O5S and a molecular weight of 498.54 g/mol. Its IUPAC name is (pyridin-3-ylamino) [4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]phenyl]methanesulfinate.
| Compound Name | (pyridin-3-ylamino) [4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]phenyl]methanesulfinate |
|---|---|
| PubChem CID | 88863670 |
| Molecular Formula | C24H23FN4O5S |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | (pyridin-3-ylamino) [4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]phenyl]methanesulfinate |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(-c3ccc(CS(=O)ONc4cccnc4)cc3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C24H23FN4O5S/c1-16(30)27-13-21-14-29(24(31)33-21)20-8-9-22(23(25)11-20)18-6-4-17(5-7-18)15-35(32)34-28-19-3-2-10-26-12-19/h2-12,21,28H,13-15H2,1H3,(H,27,30)/t21-,35?/m0/s1 |
| InChIKey | KUFIUNTWLFSZKW-YEMWWFHJSA-N |
| XLogP | 3.56 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|