C19H18FIN2O4S — CID 143007056
[4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]phenyl]methanesulfinyl iodide (PubChem CID 143007056) has the molecular formula C19H18FIN2O4S and a molecular weight of 516.33 g/mol. Its IUPAC name is [4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]phenyl]methanesulfinyl iodide.
| Compound Name | [4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]phenyl]methanesulfinyl iodide |
|---|---|
| PubChem CID | 143007056 |
| Molecular Formula | C19H18FIN2O4S |
| Molecular Weight | 516.33 g/mol |
| Exact Mass | 516.00 |
| IUPAC Name | [4-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]phenyl]methanesulfinyl iodide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(-c3ccc(CS(=O)I)cc3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C19H18FIN2O4S/c1-12(24)22-9-16-10-23(19(25)27-16)15-6-7-17(18(20)8-15)14-4-2-13(3-5-14)11-28(21)26/h2-8,16H,9-11H2,1H3,(H,22,24)/t16-,28?/m0/s1 |
| InChIKey | NQLZNWUWBOOFEB-WCZHWJSASA-N |
| XLogP | 3.55 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|