C19H19FN2O3Sr — CID 173478166
strontium;N-[[(5S)-3-[3-fluoro-4-(4-methanidylphenyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide;hydride (PubChem CID 173478166) has the molecular formula C19H19FN2O3Sr and a molecular weight of 429.99 g/mol. Its IUPAC name is strontium;N-[[(5S)-3-[3-fluoro-4-(4-methanidylphenyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide;hydride.
| Compound Name | strontium;N-[[(5S)-3-[3-fluoro-4-(4-methanidylphenyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide;hydride |
|---|---|
| PubChem CID | 173478166 |
| Molecular Formula | C19H19FN2O3Sr |
| Molecular Weight | 429.99 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | strontium;N-[[(5S)-3-[3-fluoro-4-(4-methanidylphenyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide;hydride |
| SMILES | [CH2-]c1ccc(-c2ccc(N3C[C@H](CNC(C)=O)OC3=O)cc2F)cc1.[H-].[Sr+2] |
| InChI | InChI=1S/C19H18FN2O3.Sr.H/c1-12-3-5-14(6-4-12)17-8-7-15(9-18(17)20)22-11-16(25-19(22)24)10-21-13(2)23;;/h3-9,16H,1,10-11H2,2H3,(H,21,23);;/q-1;+2;-1/t16-;;/m0../s1 |
| InChIKey | SJWXXUWWWRBBPD-SQKCAUCHSA-N |
| XLogP | 2.87 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.99 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|