C25H31FN4O5 — CID 142898165
N-[2-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluoroanilino]ethyl]-4-(4-methoxyphenyl)butanamide (PubChem CID 142898165) has the molecular formula C25H31FN4O5 and a molecular weight of 486.54 g/mol. Its IUPAC name is N-[2-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluoroanilino]ethyl]-4-(4-methoxyphenyl)butanamide.
| Compound Name | N-[2-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluoroanilino]ethyl]-4-(4-methoxyphenyl)butanamide |
|---|---|
| PubChem CID | 142898165 |
| Molecular Formula | C25H31FN4O5 |
| Molecular Weight | 486.54 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | N-[2-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluoroanilino]ethyl]-4-(4-methoxyphenyl)butanamide |
| SMILES | COc1ccc(CCCC(=O)NCCNc2ccc(N3C[C@H](CNC(C)=O)OC3=O)cc2F)cc1 |
| InChI | InChI=1S/C25H31FN4O5/c1-17(31)29-15-21-16-30(25(33)35-21)19-8-11-23(22(26)14-19)27-12-13-28-24(32)5-3-4-18-6-9-20(34-2)10-7-18/h6-11,14,21,27H,3-5,12-13,15-16H2,1-2H3,(H,28,32)(H,29,31)/t21-/m0/s1 |
| InChIKey | PIPPOPJYYWETKE-NRFANRHFSA-N |
| XLogP | 2.85 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.54 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|