C20H26F4N4O6 — CID 89217914
methyl 2-[2-[4-[(5S)-5-[[(2,2-difluoroacetyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-N-ethyl-2,6-difluoroanilino]ethyl-methoxyamino]acetate (PubChem CID 89217914) has the molecular formula C20H26F4N4O6 and a molecular weight of 494.44 g/mol. Its IUPAC name is methyl 2-[2-[4-[(5S)-5-[[(2,2-difluoroacetyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-N-ethyl-2,6-difluoroanilino]ethyl-methoxyamino]acetate.
| Compound Name | methyl 2-[2-[4-[(5S)-5-[[(2,2-difluoroacetyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-N-ethyl-2,6-difluoroanilino]ethyl-methoxyamino]acetate |
|---|---|
| PubChem CID | 89217914 |
| Molecular Formula | C20H26F4N4O6 |
| Molecular Weight | 494.44 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | methyl 2-[2-[4-[(5S)-5-[[(2,2-difluoroacetyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-N-ethyl-2,6-difluoroanilino]ethyl-methoxyamino]acetate |
| SMILES | CCN(CCN(CC(=O)OC)OC)c1c(F)cc(N2C[C@H](CNC(=O)C(F)F)OC2=O)cc1F |
| InChI | InChI=1S/C20H26F4N4O6/c1-4-26(5-6-27(33-3)11-16(29)32-2)17-14(21)7-12(8-15(17)22)28-10-13(34-20(28)31)9-25-19(30)18(23)24/h7-8,13,18H,4-6,9-11H2,1-3H3,(H,25,30)/t13-/m0/s1 |
| InChIKey | XHENFBAKJISYEM-ZDUSSCGKSA-N |
| XLogP | 1.53 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|