C19H24F3N5O6 — CID 71043870
2-[[2-[4-[(5S)-5-[[(2,2-difluoroacetyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-N-ethyl-2-fluoroanilino]ethylamino]-methylamino]-2-oxoacetic acid (PubChem CID 71043870) has the molecular formula C19H24F3N5O6 and a molecular weight of 475.42 g/mol. Its IUPAC name is 2-[[2-[4-[(5S)-5-[[(2,2-difluoroacetyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-N-ethyl-2-fluoroanilino]ethylamino]-methylamino]-2-oxoacetic acid.
| Compound Name | 2-[[2-[4-[(5S)-5-[[(2,2-difluoroacetyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-N-ethyl-2-fluoroanilino]ethylamino]-methylamino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 71043870 |
| Molecular Formula | C19H24F3N5O6 |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 2-[[2-[4-[(5S)-5-[[(2,2-difluoroacetyl)amino]methyl]-2-oxo-1,3-oxazolidin-3-yl]-N-ethyl-2-fluoroanilino]ethylamino]-methylamino]-2-oxoacetic acid |
| SMILES | CCN(CCNN(C)C(=O)C(=O)O)c1ccc(N2C[C@H](CNC(=O)C(F)F)OC2=O)cc1F |
| InChI | InChI=1S/C19H24F3N5O6/c1-3-26(7-6-24-25(2)17(29)18(30)31)14-5-4-11(8-13(14)20)27-10-12(33-19(27)32)9-23-16(28)15(21)22/h4-5,8,12,15,24H,3,6-7,9-10H2,1-2H3,(H,23,28)(H,30,31)/t12-/m0/s1 |
| InChIKey | BQEMTACMBPFPAL-LBPRGKRZSA-N |
| XLogP | 0.41 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|