C22H33F2N5O5 — CID 89067456
N-[2-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-N-ethyl-2-fluoroanilino]ethoxy]-2-(3-fluoropropylamino)-N-methylacetamide (PubChem CID 89067456) has the molecular formula C22H33F2N5O5 and a molecular weight of 485.53 g/mol. Its IUPAC name is N-[2-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-N-ethyl-2-fluoroanilino]ethoxy]-2-(3-fluoropropylamino)-N-methylacetamide.
| Compound Name | N-[2-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-N-ethyl-2-fluoroanilino]ethoxy]-2-(3-fluoropropylamino)-N-methylacetamide |
|---|---|
| PubChem CID | 89067456 |
| Molecular Formula | C22H33F2N5O5 |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | N-[2-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-N-ethyl-2-fluoroanilino]ethoxy]-2-(3-fluoropropylamino)-N-methylacetamide |
| SMILES | CCN(CCON(C)C(=O)CNCCCF)c1ccc(N2C[C@H](CNC(C)=O)OC2=O)cc1F |
| InChI | InChI=1S/C22H33F2N5O5/c1-4-28(10-11-33-27(3)21(31)14-25-9-5-8-23)20-7-6-17(12-19(20)24)29-15-18(34-22(29)32)13-26-16(2)30/h6-7,12,18,25H,4-5,8-11,13-15H2,1-3H3,(H,26,30)/t18-/m0/s1 |
| InChIKey | MPAXJDGJBZGVQZ-SFHVURJKSA-N |
| XLogP | 1.45 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|