C20H27FN8O5 — CID 89217878
N-[2-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-N-ethyl-2-fluoroanilino]ethoxy]-N-methyl-2-(tetrazol-2-yl)acetamide (PubChem CID 89217878) has the molecular formula C20H27FN8O5 and a molecular weight of 478.49 g/mol. Its IUPAC name is N-[2-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-N-ethyl-2-fluoroanilino]ethoxy]-N-methyl-2-(tetrazol-2-yl)acetamide.
| Compound Name | N-[2-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-N-ethyl-2-fluoroanilino]ethoxy]-N-methyl-2-(tetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 89217878 |
| Molecular Formula | C20H27FN8O5 |
| Molecular Weight | 478.49 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | N-[2-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-N-ethyl-2-fluoroanilino]ethoxy]-N-methyl-2-(tetrazol-2-yl)acetamide |
| SMILES | CCN(CCON(C)C(=O)Cn1ncnn1)c1ccc(N2C[C@H](CNC(C)=O)OC2=O)cc1F |
| InChI | InChI=1S/C20H27FN8O5/c1-4-27(7-8-33-26(3)19(31)12-29-24-13-23-25-29)18-6-5-15(9-17(18)21)28-11-16(34-20(28)32)10-22-14(2)30/h5-6,9,13,16H,4,7-8,10-12H2,1-3H3,(H,22,30)/t16-/m0/s1 |
| InChIKey | GGLICPCMPFVSCU-INIZCTEOSA-N |
| XLogP | 0.19 |
| TPSA | 135.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.49 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|