C17H26FN2O4P — CID 91354985
[3-[4-[ethyl(2-propan-2-yloxyethyl)amino]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methylphosphinous acid (PubChem CID 91354985) has the molecular formula C17H26FN2O4P and a molecular weight of 372.38 g/mol. Its IUPAC name is [3-[4-[ethyl(2-propan-2-yloxyethyl)amino]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methylphosphinous acid.
| Compound Name | [3-[4-[ethyl(2-propan-2-yloxyethyl)amino]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methylphosphinous acid |
|---|---|
| PubChem CID | 91354985 |
| Molecular Formula | C17H26FN2O4P |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | [3-[4-[ethyl(2-propan-2-yloxyethyl)amino]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methylphosphinous acid |
| SMILES | CCN(CCOC(C)C)c1ccc(N2CC(CPO)OC2=O)cc1F |
| InChI | InChI=1S/C17H26FN2O4P/c1-4-19(7-8-23-12(2)3)16-6-5-13(9-15(16)18)20-10-14(11-25-22)24-17(20)21/h5-6,9,12,14,22,25H,4,7-8,10-11H2,1-3H3 |
| InChIKey | WHAUYOPZEWCMSA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|