C22H31FN8O5 — CID 89217947
N-[2-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-N-ethyl-2-fluoroanilino]ethoxy]-N-methyl-2-(2H-triazol-4-ylmethylamino)acetamide (PubChem CID 89217947) has the molecular formula C22H31FN8O5 and a molecular weight of 506.54 g/mol. Its IUPAC name is N-[2-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-N-ethyl-2-fluoroanilino]ethoxy]-N-methyl-2-(2H-triazol-4-ylmethylamino)acetamide.
| Compound Name | N-[2-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-N-ethyl-2-fluoroanilino]ethoxy]-N-methyl-2-(2H-triazol-4-ylmethylamino)acetamide |
|---|---|
| PubChem CID | 89217947 |
| Molecular Formula | C22H31FN8O5 |
| Molecular Weight | 506.54 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | N-[2-[4-[(5S)-5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-N-ethyl-2-fluoroanilino]ethoxy]-N-methyl-2-(2H-triazol-4-ylmethylamino)acetamide |
| SMILES | CCN(CCON(C)C(=O)CNCc1cn[nH]n1)c1ccc(N2C[C@H](CNC(C)=O)OC2=O)cc1F |
| InChI | InChI=1S/C22H31FN8O5/c1-4-30(7-8-35-29(3)21(33)13-24-10-16-11-26-28-27-16)20-6-5-17(9-19(20)23)31-14-18(36-22(31)34)12-25-15(2)32/h5-6,9,11,18,24H,4,7-8,10,12-14H2,1-3H3,(H,25,32)(H,26,27,28)/t18-/m0/s1 |
| InChIKey | KJLOZMNJZYCCQG-SFHVURJKSA-N |
| XLogP | 0.41 |
| TPSA | 145.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.54 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|