C18H22FN7O3 — CID 174419361
N-[[3-[3-fluoro-4-[4-(2H-triazol-4-yl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 174419361) has the molecular formula C18H22FN7O3 and a molecular weight of 403.42 g/mol. Its IUPAC name is N-[[3-[3-fluoro-4-[4-(2H-triazol-4-yl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[3-[3-fluoro-4-[4-(2H-triazol-4-yl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 174419361 |
| Molecular Formula | C18H22FN7O3 |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | N-[[3-[3-fluoro-4-[4-(2H-triazol-4-yl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CN(c2ccc(N3CCN(c4cn[nH]n4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C18H22FN7O3/c1-12(27)20-9-14-11-26(18(28)29-14)13-2-3-16(15(19)8-13)24-4-6-25(7-5-24)17-10-21-23-22-17/h2-3,8,10,14H,4-7,9,11H2,1H3,(H,20,27)(H,21,22,23) |
| InChIKey | MEHWMCBRDRPNSM-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|