C20H24FN5O7 — CID 70848499
N'-[2-[N-ethyl-2-fluoro-4-[(5R)-5-(hydroxymethyl)-2-oxo-1,3-oxazolidin-3-yl]anilino]ethyl]-N-methyl-5-nitrofuran-2-carbohydrazide (PubChem CID 70848499) has the molecular formula C20H24FN5O7 and a molecular weight of 465.44 g/mol. Its IUPAC name is N'-[2-[N-ethyl-2-fluoro-4-[(5R)-5-(hydroxymethyl)-2-oxo-1,3-oxazolidin-3-yl]anilino]ethyl]-N-methyl-5-nitrofuran-2-carbohydrazide.
| Compound Name | N'-[2-[N-ethyl-2-fluoro-4-[(5R)-5-(hydroxymethyl)-2-oxo-1,3-oxazolidin-3-yl]anilino]ethyl]-N-methyl-5-nitrofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 70848499 |
| Molecular Formula | C20H24FN5O7 |
| Molecular Weight | 465.44 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | N'-[2-[N-ethyl-2-fluoro-4-[(5R)-5-(hydroxymethyl)-2-oxo-1,3-oxazolidin-3-yl]anilino]ethyl]-N-methyl-5-nitrofuran-2-carbohydrazide |
| SMILES | CCN(CCNN(C)C(=O)c1ccc([N+](=O)[O-])o1)c1ccc(N2C[C@H](CO)OC2=O)cc1F |
| InChI | InChI=1S/C20H24FN5O7/c1-3-24(9-8-22-23(2)19(28)17-6-7-18(33-17)26(30)31)16-5-4-13(10-15(16)21)25-11-14(12-27)32-20(25)29/h4-7,10,14,22,27H,3,8-9,11-12H2,1-2H3/t14-/m1/s1 |
| InChIKey | OHWWNVLIUGWVRA-CQSZACIVSA-N |
| XLogP | 1.75 |
| TPSA | 141.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|