C25H30FN5O7 — CID 10302045
N-[[(5S)-3-[3-fluoro-4-[3-methyl-4-[methyl-[2-(5-nitrofuran-2-yl)-2-oxoethyl]amino]piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 10302045) has the molecular formula C25H30FN5O7 and a molecular weight of 531.54 g/mol. Its IUPAC name is N-[[(5S)-3-[3-fluoro-4-[3-methyl-4-[methyl-[2-(5-nitrofuran-2-yl)-2-oxoethyl]amino]piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[3-fluoro-4-[3-methyl-4-[methyl-[2-(5-nitrofuran-2-yl)-2-oxoethyl]amino]piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 10302045 |
| Molecular Formula | C25H30FN5O7 |
| Molecular Weight | 531.54 g/mol |
| Exact Mass | 531.21 |
| IUPAC Name | N-[[(5S)-3-[3-fluoro-4-[3-methyl-4-[methyl-[2-(5-nitrofuran-2-yl)-2-oxoethyl]amino]piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(N3CCC(N(C)CC(=O)c4ccc([N+](=O)[O-])o4)C(C)C3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C25H30FN5O7/c1-15-12-29(9-8-20(15)28(3)14-22(33)23-6-7-24(38-23)31(35)36)21-5-4-17(10-19(21)26)30-13-18(37-25(30)34)11-27-16(2)32/h4-7,10,15,18,20H,8-9,11-14H2,1-3H3,(H,27,32)/t15?,18-,20?/m0/s1 |
| InChIKey | WUNLWEVRAIDAOR-VDUSKEEQSA-N |
| XLogP | 2.82 |
| TPSA | 138.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.54 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|