C22H26FN5O6 — CID 10205744
N-[[(5S)-3-[3-fluoro-4-[2-methyl-4-[(5-nitrofuran-2-yl)methyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 10205744) has the molecular formula C22H26FN5O6 and a molecular weight of 475.48 g/mol. Its IUPAC name is N-[[(5S)-3-[3-fluoro-4-[2-methyl-4-[(5-nitrofuran-2-yl)methyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[3-fluoro-4-[2-methyl-4-[(5-nitrofuran-2-yl)methyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 10205744 |
| Molecular Formula | C22H26FN5O6 |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | N-[[(5S)-3-[3-fluoro-4-[2-methyl-4-[(5-nitrofuran-2-yl)methyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(N3CCN(Cc4ccc([N+](=O)[O-])o4)CC3C)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C22H26FN5O6/c1-14-11-25(12-17-4-6-21(33-17)28(31)32)7-8-26(14)20-5-3-16(9-19(20)23)27-13-18(34-22(27)30)10-24-15(2)29/h3-6,9,14,18H,7-8,10-13H2,1-2H3,(H,24,29)/t14?,18-/m0/s1 |
| InChIKey | QJUHJINNIKCAGA-IBYPIGCZSA-N |
| XLogP | 2.50 |
| TPSA | 121.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|