C21H24FN5O5S2 — CID 45486023
methyl N-[[(5S)-3-[3-fluoro-4-[4-[(5-nitrofuran-2-yl)methyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamodithioate (PubChem CID 45486023) has the molecular formula C21H24FN5O5S2 and a molecular weight of 509.59 g/mol. Its IUPAC name is methyl N-[[(5S)-3-[3-fluoro-4-[4-[(5-nitrofuran-2-yl)methyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamodithioate.
| Compound Name | methyl N-[[(5S)-3-[3-fluoro-4-[4-[(5-nitrofuran-2-yl)methyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamodithioate |
|---|---|
| PubChem CID | 45486023 |
| Molecular Formula | C21H24FN5O5S2 |
| Molecular Weight | 509.59 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | methyl N-[[(5S)-3-[3-fluoro-4-[4-[(5-nitrofuran-2-yl)methyl]piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]carbamodithioate |
| SMILES | CSC(=S)NC[C@H]1CN(c2ccc(N3CCN(Cc4ccc([N+](=O)[O-])o4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C21H24FN5O5S2/c1-34-20(33)23-11-16-13-26(21(28)32-16)14-2-4-18(17(22)10-14)25-8-6-24(7-9-25)12-15-3-5-19(31-15)27(29)30/h2-5,10,16H,6-9,11-13H2,1H3,(H,23,33)/t16-/m0/s1 |
| InChIKey | XJSIXJKCVWOZAB-INIZCTEOSA-N |
| XLogP | 3.21 |
| TPSA | 104.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.59 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|