C24H28FN5O5S — CID 85136315
1-cyclopropyl-3-[[3-[3-fluoro-4-[1-[(5-nitrofuran-2-yl)methyl]piperidin-4-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]thiourea (PubChem CID 85136315) has the molecular formula C24H28FN5O5S and a molecular weight of 517.58 g/mol. Its IUPAC name is 1-cyclopropyl-3-[[3-[3-fluoro-4-[1-[(5-nitrofuran-2-yl)methyl]piperidin-4-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]thiourea.
| Compound Name | 1-cyclopropyl-3-[[3-[3-fluoro-4-[1-[(5-nitrofuran-2-yl)methyl]piperidin-4-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]thiourea |
|---|---|
| PubChem CID | 85136315 |
| Molecular Formula | C24H28FN5O5S |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | 1-cyclopropyl-3-[[3-[3-fluoro-4-[1-[(5-nitrofuran-2-yl)methyl]piperidin-4-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]thiourea |
| SMILES | O=C1OC(CNC(=S)NC2CC2)CN1c1ccc(C2CCN(Cc3ccc([N+](=O)[O-])o3)CC2)c(F)c1 |
| InChI | InChI=1S/C24H28FN5O5S/c25-21-11-17(29-14-19(35-24(29)31)12-26-23(36)27-16-1-2-16)3-5-20(21)15-7-9-28(10-8-15)13-18-4-6-22(34-18)30(32)33/h3-6,11,15-16,19H,1-2,7-10,12-14H2,(H2,26,27,36) |
| InChIKey | ITVBFQCMZMRJQF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 113.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|