C26H26F2N4O8S — CID 87630354
2-[(5R)-3-[3-fluoro-4-[3-fluoro-4-[4-[(5-nitrofuran-2-yl)methyl]piperazin-1-yl]phenyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]ethanesulfonic acid (PubChem CID 87630354) has the molecular formula C26H26F2N4O8S and a molecular weight of 592.58 g/mol. Its IUPAC name is 2-[(5R)-3-[3-fluoro-4-[3-fluoro-4-[4-[(5-nitrofuran-2-yl)methyl]piperazin-1-yl]phenyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]ethanesulfonic acid.
| Compound Name | 2-[(5R)-3-[3-fluoro-4-[3-fluoro-4-[4-[(5-nitrofuran-2-yl)methyl]piperazin-1-yl]phenyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 87630354 |
| Molecular Formula | C26H26F2N4O8S |
| Molecular Weight | 592.58 g/mol |
| Exact Mass | 592.14 |
| IUPAC Name | 2-[(5R)-3-[3-fluoro-4-[3-fluoro-4-[4-[(5-nitrofuran-2-yl)methyl]piperazin-1-yl]phenyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]ethanesulfonic acid |
| SMILES | O=C1O[C@H](CCS(=O)(=O)O)CN1c1ccc(-c2ccc(N3CCN(Cc4ccc([N+](=O)[O-])o4)CC3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C26H26F2N4O8S/c27-22-14-18(31-16-20(40-26(31)33)7-12-41(36,37)38)2-4-21(22)17-1-5-24(23(28)13-17)30-10-8-29(9-11-30)15-19-3-6-25(39-19)32(34)35/h1-6,13-14,20H,7-12,15-16H2,(H,36,37,38)/t20-/m1/s1 |
| InChIKey | AQBWBRHCHVDSJD-HXUWFJFHSA-N |
| XLogP | 4.06 |
| TPSA | 146.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.58 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|